cas: 532987-19-2 — see every product listed under this CAS number, including other names
(R)-2-Amino-2-(3-methoxyphenyl)ethanol hydrochloride, 98% (CAS 532987-19-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F690615-100MG |
| cas | 532987-19-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 128.10 Pln | |
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 500mg | 253.05 Pln | |
| Fluorochem | 1g | 445.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-2-amino-2-(3-methoxyphenyl)ethanol;hydrochloride (CAS 532987-19-2) is a chemical compound with the molecular formula C9H14ClNO2 and a molecular weight of 203.66 g/mol. IUPAC name: (2R)-2-amino-2-(3-methoxyphenyl)ethanol;hydrochloride. InChIKey: CHLMFPQGTHFLAT-FVGYRXGTSA-N.
| Molecular formula | C9H14ClNO2 |
|---|---|
| Molecular weight | 203.66 g/mol |
| IUPAC name | (2R)-2-amino-2-(3-methoxyphenyl)ethanol;hydrochloride |
| InChIKey | CHLMFPQGTHFLAT-FVGYRXGTSA-N |
| SMILES | COC1=CC=CC(=C1)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)