cas: 60115-45-9 — see every product listed under this CAS number, including other names
(R)-2-Amino-3-((2-nitrophenyl)thio)propanoic acid, 95+%, 95+% (CAS 60115-45-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114UEO-100mg |
| cas | 60115-45-9 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 218.00 Pln | |
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 602.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-amino-3-(2-nitrophenyl)sulfanylpropanoic acid (CAS 60115-45-9) is a chemical compound with the molecular formula C9H10N2O4S and a molecular weight of 242.25 g/mol. IUPAC name: (2R)-2-amino-3-(2-nitrophenyl)sulfanylpropanoic acid. InChIKey: NDZOOTLIHLSPMZ-LURJTMIESA-N.
| Molecular formula | C9H10N2O4S |
|---|---|
| Molecular weight | 242.25 g/mol |
| IUPAC name | (2R)-2-amino-3-(2-nitrophenyl)sulfanylpropanoic acid |
| InChIKey | NDZOOTLIHLSPMZ-LURJTMIESA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])SC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)