Products 301163-44-0

CAS 301163-44-0 is the registry number for 5-Ethoxy-1h-benzimidazole-2-sulfonic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

6-ethoxy-1H-benzimidazole-2-sulfonic acid (CAS 301163-44-0) is a chemical compound with the molecular formula C9H10N2O4S and a molecular weight of 242.25 g/mol. IUPAC name: 6-ethoxy-1H-benzimidazole-2-sulfonic acid. InChIKey: ZJBCFDFJDUTQLB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10N2O4S
Molecular weight242.25 g/mol
IUPAC name6-ethoxy-1H-benzimidazole-2-sulfonic acid
InChIKeyZJBCFDFJDUTQLB-UHFFFAOYSA-N
SMILESCCOC1=CC2=C(C=C1)N=C(N2)S(=O)(=O)O

Computed by PubChem (NCBI)