CAS 312523-56-1 is the registry number for 1-(Methylsulfonyl)-5-nitroindoline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-methylsulfonyl-5-nitro-2,3-dihydroindole (CAS 312523-56-1) is a chemical compound with the molecular formula C9H10N2O4S and a molecular weight of 242.25 g/mol. IUPAC name: 1-methylsulfonyl-5-nitro-2,3-dihydroindole. InChIKey: NRBRMCAQIDGPNX-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4S |
|---|---|
| Molecular weight | 242.25 g/mol |
| IUPAC name | 1-methylsulfonyl-5-nitro-2,3-dihydroindole |
| InChIKey | NRBRMCAQIDGPNX-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCC2=C1C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)