Products 1373232-34-8

CAS 1373232-34-8 is the registry number for N-(2-Nitrophenyl)-1,3-propanesultam, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

2-(2-nitrophenyl)-1,2-thiazolidine 1,1-dioxide (CAS 1373232-34-8) is a chemical compound with the molecular formula C9H10N2O4S and a molecular weight of 242.25 g/mol. IUPAC name: 2-(2-nitrophenyl)-1,2-thiazolidine 1,1-dioxide. InChIKey: NZSQAOFLIWSBBN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10N2O4S
Molecular weight242.25 g/mol
IUPAC name2-(2-nitrophenyl)-1,2-thiazolidine 1,1-dioxide
InChIKeyNZSQAOFLIWSBBN-UHFFFAOYSA-N
SMILESC1CN(S(=O)(=O)C1)C2=CC=CC=C2[N+](=O)[O-]

Computed by PubChem (NCBI)