CAS 1373232-34-8 is the registry number for N-(2-Nitrophenyl)-1,3-propanesultam, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
2-(2-nitrophenyl)-1,2-thiazolidine 1,1-dioxide (CAS 1373232-34-8) is a chemical compound with the molecular formula C9H10N2O4S and a molecular weight of 242.25 g/mol. IUPAC name: 2-(2-nitrophenyl)-1,2-thiazolidine 1,1-dioxide. InChIKey: NZSQAOFLIWSBBN-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4S |
|---|---|
| Molecular weight | 242.25 g/mol |
| IUPAC name | 2-(2-nitrophenyl)-1,2-thiazolidine 1,1-dioxide |
| InChIKey | NZSQAOFLIWSBBN-UHFFFAOYSA-N |
| SMILES | C1CN(S(=O)(=O)C1)C2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)