cas: 141979-69-3 — see every product listed under this CAS number, including other names
(R)-2-Amino-3-(4-methyl-1H-indol-3-yl)propanoic acid, 97% (CAS 141979-69-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F541404-1G |
| cas | 141979-69-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 4767.09 Pln | |
| Fluorochem | 250mg | 2132.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-2-amino-3-(4-methyl-1H-indol-3-yl)propanoic acid (CAS 141979-69-3) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: (2R)-2-amino-3-(4-methyl-1H-indol-3-yl)propanoic acid. InChIKey: FPJGLSZLQLNZIW-SECBINFHSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-methyl-1H-indol-3-yl)propanoic acid |
| InChIKey | FPJGLSZLQLNZIW-SECBINFHSA-N |
| SMILES | CC1=C2C(=CC=C1)NC=C2C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)