Products 1153985-64-8

CAS 1153985-64-8 is the registry number for 1-t-Butyl-benzoimidazole-5-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

1-tert-butylbenzimidazole-5-carboxylic acid (CAS 1153985-64-8) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: 1-tert-butylbenzimidazole-5-carboxylic acid. InChIKey: FSOOAHYUSUSXLS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14N2O2
Molecular weight218.25 g/mol
IUPAC name1-tert-butylbenzimidazole-5-carboxylic acid
InChIKeyFSOOAHYUSUSXLS-UHFFFAOYSA-N
SMILESCC(C)(C)N1C=NC2=C1C=CC(=C2)C(=O)O

Computed by PubChem (NCBI)