CAS 141979-69-3 appears in our catalog under these names: (R)–2–Amino–3–(4–methyl–1H–indol–3–yl)propanoic acid, (R)-2-Amino-3-(4-methyl-1H-indol-3-yl)propanoic acid, 97%, 4-Methyl-d-tryptophan, 95%, H-D-Trp(4-Me)-OH 97%, 4-Methyl-D-tryptophan, 97%, 97%. Offered by: GLPBio, Fluorochem, Combi-blocks, Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-amino-3-(4-methyl-1H-indol-3-yl)propanoic acid (CAS 141979-69-3) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: (2R)-2-amino-3-(4-methyl-1H-indol-3-yl)propanoic acid. InChIKey: FPJGLSZLQLNZIW-SECBINFHSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-methyl-1H-indol-3-yl)propanoic acid |
| InChIKey | FPJGLSZLQLNZIW-SECBINFHSA-N |
| SMILES | CC1=C2C(=CC=C1)NC=C2C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)