CAS 342801-19-8 is the registry number for 2(1H)-Quinazolinone, 7-methoxy-8-(1-methylethyl)-, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
7-methoxy-8-propan-2-yl-1H-quinazolin-2-one (CAS 342801-19-8) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: 7-methoxy-8-propan-2-yl-1H-quinazolin-2-one. InChIKey: BICUCIXLXWVJKG-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 7-methoxy-8-propan-2-yl-1H-quinazolin-2-one |
| InChIKey | BICUCIXLXWVJKG-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=CC2=C1NC(=O)N=C2)OC |
Computed by PubChem (NCBI)