cas: 7620-28-2 — see every product listed under this CAS number, including other names
(R)-2-Amino-hexanedioic acid, 95% (CAS 7620-28-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F048076-1G |
| cas | 7620-28-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 112.48 Pln | |
| Fluorochem | 10g | 143.72 Pln | |
| Fluorochem | 25g | 279.09 Pln | |
| Fluorochem | 100g | 659.16 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
D-2-aminoadipic acid is an optically active form of 2-aminoadipic acid having D-configuration. It has a role as a metabolite. It is an enantiomer of a L-2-aminoadipic acid.
Source: ChEBI
| Molecular formula | C6H11NO4 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | (2R)-2-aminohexanedioic acid |
| InChIKey | OYIFNHCXNCRBQI-SCSAIBSYSA-N |
| SMILES | C(C[C@H](C(=O)O)N)CC(=O)O |
Computed by PubChem (NCBI)