H-D-Aad-OH 98%
cas: 7620-28-2 — see every product listed under this CAS number, including other names
H-D-Aad-OH 98% (CAS 7620-28-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A187348-1g |
| cas | 7620-28-2 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 186.81 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 231.31 Pln | |
| Ambeed | 100g | 654.06 Pln | |
| Ambeed | 500g | 2990.31 Pln | |
| Ambeed | 1000g | 5810.50 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A187348 |
D-2-aminoadipic acid is an optically active form of 2-aminoadipic acid having D-configuration. It has a role as a metabolite. It is an enantiomer of a L-2-aminoadipic acid.
Source: ChEBI
| Molecular formula | C6H11NO4 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | (2R)-2-aminohexanedioic acid |
| InChIKey | OYIFNHCXNCRBQI-SCSAIBSYSA-N |
| SMILES | C(C[C@H](C(=O)O)N)CC(=O)O |
Computed by PubChem (NCBI)