cas: 7620-28-2 — see every product listed under this CAS number, including other names
(R)-2-Aminohexanedioic acid, 98%, 98% (CAS 7620-28-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1143EV-1g |
| cas | 7620-28-2 |
| size | 1g |
| availability | 395g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 25g | 165.20 Pln | |
| Chemat | 50g | 256.40 Pln | |
| Chemat | 100g | 438.80 Pln | |
| Chemat | 250g | 957.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
D-2-aminoadipic acid is an optically active form of 2-aminoadipic acid having D-configuration. It has a role as a metabolite. It is an enantiomer of a L-2-aminoadipic acid.
Source: ChEBI
| Molecular formula | C6H11NO4 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | (2R)-2-aminohexanedioic acid |
| InChIKey | OYIFNHCXNCRBQI-SCSAIBSYSA-N |
| SMILES | C(C[C@H](C(=O)O)N)CC(=O)O |
Computed by PubChem (NCBI)