cas: 107171-75-5 — see every product listed under this CAS number, including other names
(R)-2-Benzylamino-1-phenylethanol, 97%, 97% (CAS 107171-75-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119UHC-1g |
| cas | 107171-75-5 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 218.00 Pln | |
| Chemat | 10g | 333.20 Pln | |
| Chemat | 25g | 563.60 Pln | |
| Chemat | 50g | 1029.20 Pln | |
| Chemat | 100g | 1739.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(1R)-2-(benzylamino)-1-phenylethanol (CAS 107171-75-5) is a chemical compound with the molecular formula C15H17NO and a molecular weight of 227.30 g/mol. IUPAC name: (1R)-2-(benzylamino)-1-phenylethanol. InChIKey: XAOCLQUZOIZSHV-HNNXBMFYSA-N.
| Molecular formula | C15H17NO |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | (1R)-2-(benzylamino)-1-phenylethanol |
| InChIKey | XAOCLQUZOIZSHV-HNNXBMFYSA-N |
| SMILES | C1=CC=C(C=C1)CNC[C@@H](C2=CC=CC=C2)O |
Computed by PubChem (NCBI)