CAS 51096-49-2 appears in our catalog under these names: (S)–(+)–2–Benzylamino–1–phenylethanol, (S)-(+)-2-Benzylamino-1-phenylethanol, 98%, S-(-)-2-BenzylaMino-1-phenylethanol, 95%, 95%. Offered by: GLPBio, Combi-blocks, Chemat. Available pack sizes: 25g, 5g, 10g, 1g, 100g, 50g.
(1S)-2-(benzylamino)-1-phenylethanol (CAS 51096-49-2) is a chemical compound with the molecular formula C15H17NO and a molecular weight of 227.30 g/mol. IUPAC name: (1S)-2-(benzylamino)-1-phenylethanol. InChIKey: XAOCLQUZOIZSHV-OAHLLOKOSA-N.
| Molecular formula | C15H17NO |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | (1S)-2-(benzylamino)-1-phenylethanol |
| InChIKey | XAOCLQUZOIZSHV-OAHLLOKOSA-N |
| SMILES | C1=CC=C(C=C1)CNC[C@H](C2=CC=CC=C2)O |
Computed by PubChem (NCBI)