cas: 51600-25-0 — see every product listed under this CAS number, including other names
(R)-2-Methyl-1-phenylpropan-1-amine hydrochloride 95% (CAS 51600-25-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A156237-250mg |
| cas | 51600-25-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 459.38 Pln | |
| Ambeed | 1g | 943.31 Pln | |
| Ambeed | 5g | 4436.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A156237 |
(1R)-2-methyl-1-phenylpropan-1-amine;hydrochloride (CAS 51600-25-0) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 185.69 g/mol. IUPAC name: (1R)-2-methyl-1-phenylpropan-1-amine;hydrochloride. InChIKey: LZDSYIZUCSUNKJ-HNCPQSOCSA-N.
| Molecular formula | C10H16ClN |
|---|---|
| Molecular weight | 185.69 g/mol |
| IUPAC name | (1R)-2-methyl-1-phenylpropan-1-amine;hydrochloride |
| InChIKey | LZDSYIZUCSUNKJ-HNCPQSOCSA-N |
| SMILES | CC(C)[C@H](C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)