CAS 51600-25-0 appears in our catalog under these names: (R)-2-Methyl-1-phenylpropan-1-amine hydrochloride, 98%, (R)-2-Methyl-1-phenylpropan-1-amine Hydrochloride, (R)–2–Methyl–1–phenylpropan–1–amine hydrochloride, (R)-2-Methyl-1-phenylpropan-1-amine hydrochloride 95%, (R)-2-Methyl-1-phenylpropan-1-amine hydrochloride, 97%, 97%. Offered by: Combi-blocks, LoGiCal, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 10mg, 100mg.
(1R)-2-methyl-1-phenylpropan-1-amine;hydrochloride (CAS 51600-25-0) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 185.69 g/mol. IUPAC name: (1R)-2-methyl-1-phenylpropan-1-amine;hydrochloride. InChIKey: LZDSYIZUCSUNKJ-HNCPQSOCSA-N.
| Molecular formula | C10H16ClN |
|---|---|
| Molecular weight | 185.69 g/mol |
| IUPAC name | (1R)-2-methyl-1-phenylpropan-1-amine;hydrochloride |
| InChIKey | LZDSYIZUCSUNKJ-HNCPQSOCSA-N |
| SMILES | CC(C)[C@H](C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)