cas: 269396-71-6 — see every product listed under this CAS number, including other names
(R)-3-((tert-Butoxycarbonyl)amino)-4-(4-iodophenyl)butanoic acid, 96% (CAS 269396-71-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F689854-250MG |
| cas | 269396-71-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 253.05 Pln | |
| Fluorochem | 5g | 1013.20 Pln | |
| Fluorochem | 10g | 1965.99 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
(3R)-4-(4-iodophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 269396-71-6) is a chemical compound with the molecular formula C15H20INO4 and a molecular weight of 405.23 g/mol. IUPAC name: (3R)-4-(4-iodophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: QEKSTALXWONXOD-GFCCVEGCSA-N.
| Molecular formula | C15H20INO4 |
|---|---|
| Molecular weight | 405.23 g/mol |
| IUPAC name | (3R)-4-(4-iodophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | QEKSTALXWONXOD-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=C(C=C1)I)CC(=O)O |
Computed by PubChem (NCBI)