cas: 788153-27-5 — see every product listed under this CAS number, including other names
(R)-3-(3-BROMOPHENYL)-BETA-ALANINE, 98% (CAS 788153-27-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F792123-1G |
| cas | 788153-27-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 310.33 Pln | |
| Fluorochem | 5g | 1315.18 Pln | |
| Fluorochem | 10g | 2543.91 Pln | |
| Fluorochem | 25g | 6276.97 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3R)-3-amino-3-(3-bromophenyl)propanoic acid (CAS 788153-27-5) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: (3R)-3-amino-3-(3-bromophenyl)propanoic acid. InChIKey: RLYAXKJHJUXZOT-MRVPVSSYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | (3R)-3-amino-3-(3-bromophenyl)propanoic acid |
| InChIKey | RLYAXKJHJUXZOT-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)