cas: 788153-27-5 — see every product listed under this CAS number, including other names
H-D-β-Phe(3-Br)-OH 97% (CAS 788153-27-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A560105-100mg |
| cas | 788153-27-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 197.94 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 1349.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A560105 |
(3R)-3-amino-3-(3-bromophenyl)propanoic acid (CAS 788153-27-5) is a chemical compound with the molecular formula C9H10BrNO2 and a molecular weight of 244.08 g/mol. IUPAC name: (3R)-3-amino-3-(3-bromophenyl)propanoic acid. InChIKey: RLYAXKJHJUXZOT-MRVPVSSYSA-N.
| Molecular formula | C9H10BrNO2 |
|---|---|
| Molecular weight | 244.08 g/mol |
| IUPAC name | (3R)-3-amino-3-(3-bromophenyl)propanoic acid |
| InChIKey | RLYAXKJHJUXZOT-MRVPVSSYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)