cas: 1187932-69-9 — see every product listed under this CAS number, including other names
(R)-3-(Iodomethyl)pyrrolidine-1-carboxylic acid tert-butyl ester, 98%, 98% (CAS 1187932-69-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 5g, 250mg, 1g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119T7N-50mg |
| cas | 1187932-69-9 |
| size | 50mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 131.60 Pln | |
| Chemat | 100mg | 150.80 Pln | |
| Chemat | 5g | 3866.00 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 962.00 Pln | |
| Chemat | 10g | 6150.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3R)-3-(iodomethyl)pyrrolidine-1-carboxylate (CAS 1187932-69-9) is a chemical compound with the molecular formula C10H18INO2 and a molecular weight of 311.16 g/mol. IUPAC name: tert-butyl (3R)-3-(iodomethyl)pyrrolidine-1-carboxylate. InChIKey: DNUFVBGZKFHSDQ-QMMMGPOBSA-N.
| Molecular formula | C10H18INO2 |
|---|---|
| Molecular weight | 311.16 g/mol |
| IUPAC name | tert-butyl (3R)-3-(iodomethyl)pyrrolidine-1-carboxylate |
| InChIKey | DNUFVBGZKFHSDQ-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C1)CI |
Computed by PubChem (NCBI)