CAS 1408074-76-9 appears in our catalog under these names: 1-Boc-3-iodomethyl-3-methylazetidine, 95%, 1-Boc-3-(iodomethyl)-3-methyl-azetidine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 0,5g, 50mg.
Tert-butyl 3-(iodomethyl)-3-methylazetidine-1-carboxylate (CAS 1408074-76-9) is a chemical compound with the molecular formula C10H18INO2 and a molecular weight of 311.16 g/mol. IUPAC name: tert-butyl 3-(iodomethyl)-3-methylazetidine-1-carboxylate. InChIKey: FJNDBFYSWUNCSC-UHFFFAOYSA-N.
| Molecular formula | C10H18INO2 |
|---|---|
| Molecular weight | 311.16 g/mol |
| IUPAC name | tert-butyl 3-(iodomethyl)-3-methylazetidine-1-carboxylate |
| InChIKey | FJNDBFYSWUNCSC-UHFFFAOYSA-N |
| SMILES | CC1(CN(C1)C(=O)OC(C)(C)C)CI |
Computed by PubChem (NCBI)