CAS 224168-68-7 appears in our catalog under these names: 3(S)-Iodomethyl-pyrrolidine-1-carboxylic acid tert-butyl ester, 95%, 3(S)-Iodomethyl-pyrrolidine-1-carboxylic acid tert-butyl ester, tert-Butyl (S)-3-(iodomethyl)pyrrolidine-1-carboxylate 98%, 1-Pyrrolidinecarboxylicacid, 3-(iodomethyl)-, 1,1-dimethylethyl ester, (3S)-, 98%, 98%, 3(S)-Iodomethyl-pyrrolidine-1-carboxylic acid tert-butyl ester, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 2,5g, 100mg.
Tert-butyl (3S)-3-(iodomethyl)pyrrolidine-1-carboxylate (CAS 224168-68-7) is a chemical compound with the molecular formula C10H18INO2 and a molecular weight of 311.16 g/mol. IUPAC name: tert-butyl (3S)-3-(iodomethyl)pyrrolidine-1-carboxylate. InChIKey: DNUFVBGZKFHSDQ-MRVPVSSYSA-N.
| Molecular formula | C10H18INO2 |
|---|---|
| Molecular weight | 311.16 g/mol |
| IUPAC name | tert-butyl (3S)-3-(iodomethyl)pyrrolidine-1-carboxylate |
| InChIKey | DNUFVBGZKFHSDQ-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C1)CI |
Computed by PubChem (NCBI)