Products 850761-36-3
CAS 850761-36-3 appears in our catalog under these names: N-Boc-3-Iodopiperidine, 97%, 1-Boc-3-iodo-piperidine, 95%, tert-Butyl 3-iodopiperidine-1-carboxylate 95%, Tert-Butyl 3-Iodopiperidine-1-Carboxylate, 95%, 95%. Offered by: Fluorochem, Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg.
Tert-butyl 3-iodopiperidine-1-carboxylate (CAS 850761-36-3) is a chemical compound with the molecular formula C10H18INO2 and a molecular weight of 311.16 g/mol. IUPAC name: tert-butyl 3-iodopiperidine-1-carboxylate. InChIKey: JXEZFSNOYBRXFT-UHFFFAOYSA-N.
| Molecular formula | C10H18INO2 |
|---|---|
| Molecular weight | 311.16 g/mol |
| IUPAC name | tert-butyl 3-iodopiperidine-1-carboxylate |
| InChIKey | JXEZFSNOYBRXFT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)I |
Computed by PubChem (NCBI)