cas: 2061996-52-7 — see every product listed under this CAS number, including other names
(R)-3-Amino-3-(3,4-dimethylphenyl)propanoic acid hydrochloride, 95%, 95% (CAS 2061996-52-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DDNR-250mg |
| cas | 2061996-52-7 |
| size | 250mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 861.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(3R)-3-amino-3-(3,4-dimethylphenyl)propanoic acid;hydrochloride (CAS 2061996-52-7) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: (3R)-3-amino-3-(3,4-dimethylphenyl)propanoic acid;hydrochloride. InChIKey: ZYIPAJHUXGHXJR-HNCPQSOCSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | (3R)-3-amino-3-(3,4-dimethylphenyl)propanoic acid;hydrochloride |
| InChIKey | ZYIPAJHUXGHXJR-HNCPQSOCSA-N |
| SMILES | CC1=C(C=C(C=C1)[C@@H](CC(=O)O)N)C.Cl |
Computed by PubChem (NCBI)