Products 1810074-59-9

CAS 1810074-59-9 appears in our catalog under these names: (5R)-5-Amino-5-phenylpentanoic acid hydrochloride, 95%, (R)–5–Amino–5–phenylpentanoic acid hydrochloride, (R)-5-Amino-5-phenylpentanoic acid hydrochloride 95%, (R)-5-Amino-5-phenylpentanoic acid hydrochloride, 95%, 95%, (R)-5-Amino-5-phenylpentanoic acid hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(5R)-5-amino-5-phenylpentanoic acid;hydrochloride (CAS 1810074-59-9) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: (5R)-5-amino-5-phenylpentanoic acid;hydrochloride. InChIKey: NIKOCFCSZXBQTK-HNCPQSOCSA-N.

Identity
Molecular formulaC11H16ClNO2
Molecular weight229.70 g/mol
IUPAC name(5R)-5-amino-5-phenylpentanoic acid;hydrochloride
InChIKeyNIKOCFCSZXBQTK-HNCPQSOCSA-N
SMILESC1=CC=C(C=C1)[C@@H](CCCC(=O)O)N.Cl

Computed by PubChem (NCBI)