CAS 1810074-59-9 appears in our catalog under these names: (5R)-5-Amino-5-phenylpentanoic acid hydrochloride, 95%, (R)–5–Amino–5–phenylpentanoic acid hydrochloride, (R)-5-Amino-5-phenylpentanoic acid hydrochloride 95%, (R)-5-Amino-5-phenylpentanoic acid hydrochloride, 95%, 95%, (R)-5-Amino-5-phenylpentanoic acid hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(5R)-5-amino-5-phenylpentanoic acid;hydrochloride (CAS 1810074-59-9) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: (5R)-5-amino-5-phenylpentanoic acid;hydrochloride. InChIKey: NIKOCFCSZXBQTK-HNCPQSOCSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | (5R)-5-amino-5-phenylpentanoic acid;hydrochloride |
| InChIKey | NIKOCFCSZXBQTK-HNCPQSOCSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](CCCC(=O)O)N.Cl |
Computed by PubChem (NCBI)