Products 460039-36-5

CAS 460039-36-5 is the registry number for 3-Amino-5-phenylpentanoic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 10g.

Structural formula: {0} (CAS {1})

3-amino-5-phenylpentanoic acid;hydrochloride (CAS 460039-36-5) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: 3-amino-5-phenylpentanoic acid;hydrochloride. InChIKey: GSSXWQCQDYAEFF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16ClNO2
Molecular weight229.70 g/mol
IUPAC name3-amino-5-phenylpentanoic acid;hydrochloride
InChIKeyGSSXWQCQDYAEFF-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CCC(CC(=O)O)N.Cl

Computed by PubChem (NCBI)