CAS 2061996-52-7 appears in our catalog under these names: (R)-3-Amino-3-(3,4-dimethylphenyl)propanoic acid hydrochloride, 95%, (R)–3–Amino–3–(3,4–dimethylphenyl)propanoic acid hydrochloride, (R)-3-Amino-3-(3,4-dimethylphenyl)propanoic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
(3R)-3-amino-3-(3,4-dimethylphenyl)propanoic acid;hydrochloride (CAS 2061996-52-7) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: (3R)-3-amino-3-(3,4-dimethylphenyl)propanoic acid;hydrochloride. InChIKey: ZYIPAJHUXGHXJR-HNCPQSOCSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | (3R)-3-amino-3-(3,4-dimethylphenyl)propanoic acid;hydrochloride |
| InChIKey | ZYIPAJHUXGHXJR-HNCPQSOCSA-N |
| SMILES | CC1=C(C=C(C=C1)[C@@H](CC(=O)O)N)C.Cl |
Computed by PubChem (NCBI)