cas: 143673-66-9 — see every product listed under this CAS number, including other names
(R)-3-Isopropylpiperazine-2,5-dione 97% (CAS 143673-66-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A193943-250mg |
| cas | 143673-66-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 409.31 Pln | |
| Ambeed | 25g | 1432.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A193943 |
(3R)-3-propan-2-ylpiperazine-2,5-dione (CAS 143673-66-9) is a chemical compound with the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. IUPAC name: (3R)-3-propan-2-ylpiperazine-2,5-dione. InChIKey: IULFBTHVPRNQCG-ZCFIWIBFSA-N.
| Molecular formula | C7H12N2O2 |
|---|---|
| Molecular weight | 156.18 g/mol |
| IUPAC name | (3R)-3-propan-2-ylpiperazine-2,5-dione |
| InChIKey | IULFBTHVPRNQCG-ZCFIWIBFSA-N |
| SMILES | CC(C)[C@@H]1C(=O)NCC(=O)N1 |
Computed by PubChem (NCBI)