(R)-3-Methyl-2-phenylbutanoic acid, 97%
cas: 13491-13-9 — see every product listed under this CAS number, including other names
(R)-3-Methyl-2-phenylbutanoic acid, 97% (CAS 13491-13-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A118938-100mg |
| cas | 13491-13-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 598.44 Pln | |
| Ambeed | 5g | 2689.94 Pln | |
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 400.40 Pln | |
| BLDpharm | 100mg | 203.29 Pln | |
| BLDpharm | 250mg | 331.02 Pln | |
| BLDpharm | 1g | 642.02 Pln | |
| BLDpharm | 5g | 2896.78 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
3-methyl-2-phenylbutanoic acid (CAS 13491-13-9) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 3-methyl-2-phenylbutanoic acid. InChIKey: HDLQGISFYDYWFJ-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 3-methyl-2-phenylbutanoic acid |
| InChIKey | HDLQGISFYDYWFJ-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-methyl-2-phenylbutanoic acid, alpha-Isopropylphenylacetic acid, 3-Methyl-2-phenylbutyric acid, 3-Methyl-2-phenyl-butyric acid, 3-methyl-2-phenyl-butanoic acid, 2-phenyl-3-methylbutyric acid, Benzeneacetic acid, .alpha.-(1-methylethyl)-, Benzeneacetic acid, alpha-(1-methylethyl)-, A-Isopropylbenzeneacetic acid, |A-Isopropylphenylacetic acid