CAS 13491-13-9 appears in our catalog under these names: (R)-3-Methyl-2-phenylbutanoic acid, 95%, (R)–3–Methyl–2–phenylbutanoic acid, (R)-3-Methyl-2-phenylbutanoic acid, 97%, 97%, (R)-3-Methyl-2-phenylbutanoic acid, 98%, (R)-3-Methyl-2-phenylbutanoic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg.
3-methyl-2-phenylbutanoic acid (CAS 13491-13-9) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 3-methyl-2-phenylbutanoic acid. InChIKey: HDLQGISFYDYWFJ-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 3-methyl-2-phenylbutanoic acid |
| InChIKey | HDLQGISFYDYWFJ-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)