cas: 106092-11-9 — see every product listed under this CAS number, including other names
(R)-4,5,6,7-Tetrahydro-benzothiazole-2,6-diamine, 95% (CAS 106092-11-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F034485-1G |
| cas | 106092-11-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 10g | 206.20 Pln | |
| Fluorochem | 25g | 341.56 Pln | |
| Fluorochem | 100g | 893.45 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (CAS 106092-11-9) is a chemical compound with the molecular formula C7H11N3S and a molecular weight of 169.25 g/mol. IUPAC name: (6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine. InChIKey: DRRYZHHKWSHHFT-SCSAIBSYSA-N.
| Molecular formula | C7H11N3S |
|---|---|
| Molecular weight | 169.25 g/mol |
| IUPAC name | (6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
| InChIKey | DRRYZHHKWSHHFT-SCSAIBSYSA-N |
| SMILES | C1CC2=C(C[C@@H]1N)SC(=N2)N |
Computed by PubChem (NCBI)