CAS 106092-11-9 appears in our catalog under these names: (+)-(6R)-2,6-Diamino-4,5,6,7-tetrahydrobenzothiazole, 97%, Pramipexole Impurity 43, (R)-N-Despropyl Pramipexole, (6R)-4,5,6,7-Tetrahydro-1,3-benzothiazole-2,6-diamine, (+)–(6R)–2,6–Diamino–4,5,6,7–tetrahydrobenzothiazole. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, GLPBio. Available pack sizes: 25g, 500g, 5g, 1g, 100g, on request, 100mg, 10g.
(6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (CAS 106092-11-9) is a chemical compound with the molecular formula C7H11N3S and a molecular weight of 169.25 g/mol. IUPAC name: (6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine. InChIKey: DRRYZHHKWSHHFT-SCSAIBSYSA-N.
| Molecular formula | C7H11N3S |
|---|---|
| Molecular weight | 169.25 g/mol |
| IUPAC name | (6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
| InChIKey | DRRYZHHKWSHHFT-SCSAIBSYSA-N |
| SMILES | C1CC2=C(C[C@@H]1N)SC(=N2)N |
Computed by PubChem (NCBI)