cas: 106092-11-9 — see every product listed under this CAS number, including other names
2,6-Benzothiazolediamine, 4,5,6,7-tetrahydro-, (6R)-, 97%, 97% (CAS 106092-11-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118DOB-250mg |
| cas | 106092-11-9 |
| size | 250mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 10g | 170.00 Pln | |
| Chemat | 25g | 227.60 Pln | |
| Chemat | 100g | 731.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (CAS 106092-11-9) is a chemical compound with the molecular formula C7H11N3S and a molecular weight of 169.25 g/mol. IUPAC name: (6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine. InChIKey: DRRYZHHKWSHHFT-SCSAIBSYSA-N.
| Molecular formula | C7H11N3S |
|---|---|
| Molecular weight | 169.25 g/mol |
| IUPAC name | (6R)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
| InChIKey | DRRYZHHKWSHHFT-SCSAIBSYSA-N |
| SMILES | C1CC2=C(C[C@@H]1N)SC(=N2)N |
Computed by PubChem (NCBI)