CAS 106092-09-5 appears in our catalog under these names: Pramipexole EP Impurity A, (S)-N-Despropyl Pramipexole, >95% (HPLC), (6S)-4,5,6,7-Tetrahydro-1,3-benzothiazole-2,6-diamine, (S)–(–)–2,6–Diamino–4,5,6,7–tetrahydrobenzothiazole, (s)-2,6-Diamino-4,5,6,7-tetrahydrobenzothiazole. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 10g, 1g, 25mg, 100g, 25g, 50g.
(6S)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine (CAS 106092-09-5) is a chemical compound with the molecular formula C7H11N3S and a molecular weight of 169.25 g/mol. IUPAC name: (6S)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine. InChIKey: DRRYZHHKWSHHFT-BYPYZUCNSA-N.
| Molecular formula | C7H11N3S |
|---|---|
| Molecular weight | 169.25 g/mol |
| IUPAC name | (6S)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,6-diamine |
| InChIKey | DRRYZHHKWSHHFT-BYPYZUCNSA-N |
| SMILES | C1CC2=C(C[C@H]1N)SC(=N2)N |
Computed by PubChem (NCBI)