(R)-4-(tert-Butyl)-2-(5-chloropyridin-2-yl)-4,5-dihydrooxazole, 97% 99%ee
cas: 2757083-24-0 — see every product listed under this CAS number, including other names
(R)-4-(tert-Butyl)-2-(5-chloropyridin-2-yl)-4,5-dihydrooxazole, 97% 99%ee (CAS 2757083-24-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Fluorochem, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1493901-250mg |
| cas | 2757083-24-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1093.50 Pln | |
| Ambeed | 1g | 2117.00 Pln | |
| BLDpharm | 100mg | 625.36 Pln | |
| BLDpharm | 250mg | 1169.61 Pln | |
| BLDpharm | 1g | 2280.33 Pln | |
| Fluorochem | 1g | 4803.53 Pln | |
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 938.00 Pln | |
| Chemat | 1g | 2594.00 Pln | |
| Fluorochem | 100mg | 1060.06 Pln | |
| Fluorochem | 250mg | 1731.70 Pln |
properties
| purity | 97% 99%ee |
|---|---|
| delivery time | 1-2 weeks |
(4R)-4-tert-butyl-2-(5-chloro-2-pyridinyl)-4,5-dihydro-1,3-oxazole (CAS 2757083-24-0) is a chemical compound with the molecular formula C12H15ClN2O and a molecular weight of 238.71 g/mol. IUPAC name: (4R)-4-tert-butyl-2-(5-chloro-2-pyridinyl)-4,5-dihydro-1,3-oxazole. InChIKey: JFAYSLQIISQWOE-JTQLQIEISA-N.
| Molecular formula | C12H15ClN2O |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | (4R)-4-tert-butyl-2-(5-chloro-2-pyridinyl)-4,5-dihydro-1,3-oxazole |
| InChIKey | JFAYSLQIISQWOE-JTQLQIEISA-N |
| SMILES | CC(C)(C)[C@@H]1COC(=N1)C2=NC=C(C=C2)Cl |
Computed by PubChem (NCBI)
Synonyms:
(R)-4-(tert-Butyl)-2-(5-chloropyridin-2-yl)-4,5-dihydrooxazole, 2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]-5-chloropyridine, (4R)-4-tert-butyl-2-(5-chloro-2-pyridyl)-4,5-dihydrooxazole, (4R)-4-tert-butyl-2-(5-chloropyridin-2-yl)-4,5-dihydro-1,3-oxazole, Pyridine, 5-chloro-2-[(4R)-4-(1,1-dimethylethyl)-4,5-dihydro-2-oxazolyl]-