CAS 51420-30-5 appears in our catalog under these names: 2-Chloro-4-(4-methylpiperazino)benzaldehyde, 98%, 2-Chloro-4-(4-methylpiperazino)benzaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 25g, 5g, 1g, 2,5g.
2-chloro-4-(4-methylpiperazin-1-yl)benzaldehyde (CAS 51420-30-5) is a chemical compound with the molecular formula C12H15ClN2O and a molecular weight of 238.71 g/mol. IUPAC name: 2-chloro-4-(4-methylpiperazin-1-yl)benzaldehyde. InChIKey: JHKAOEWIJKITLH-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | 2-chloro-4-(4-methylpiperazin-1-yl)benzaldehyde |
| InChIKey | JHKAOEWIJKITLH-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC(=C(C=C2)C=O)Cl |
Computed by PubChem (NCBI)