CAS 815650-81-8 appears in our catalog under these names: 1-[(4-Chlorophenyl)carbonyl]-1,4-diazepane, 95%, 1-(4-Chlorobenzoyl)-1,4-diazepane. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
(4-chlorophenyl)-(1,4-diazepan-1-yl)methanone (CAS 815650-81-8) is a chemical compound with the molecular formula C12H15ClN2O and a molecular weight of 238.71 g/mol. IUPAC name: (4-chlorophenyl)-(1,4-diazepan-1-yl)methanone. InChIKey: SPPJCNFPUIZLBA-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | (4-chlorophenyl)-(1,4-diazepan-1-yl)methanone |
| InChIKey | SPPJCNFPUIZLBA-UHFFFAOYSA-N |
| SMILES | C1CNCCN(C1)C(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)