Products 150557-99-6
CAS 150557-99-6 appears in our catalog under these names: 1-[4-(4-chlorophenyl)piperazin-1-yl]ethan-1-one, 95%, 1-(4-(4-Chlorophenyl)piperazin-1-yl)ethan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
1-[4-(4-chlorophenyl)piperazin-1-yl]ethanone (CAS 150557-99-6) is a chemical compound with the molecular formula C12H15ClN2O and a molecular weight of 238.71 g/mol. IUPAC name: 1-[4-(4-chlorophenyl)piperazin-1-yl]ethanone. InChIKey: UVYFWYMZWQBGAQ-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | 1-[4-(4-chlorophenyl)piperazin-1-yl]ethanone |
| InChIKey | UVYFWYMZWQBGAQ-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCN(CC1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)