cas: 1637540-45-4 — see every product listed under this CAS number, including other names
(R)-4-Fluoro-2,3-dihydro-1H-inden-1-amine hydrochloride 95% (CAS 1637540-45-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A595804-100mg |
| cas | 1637540-45-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 348.12 Pln | |
| Ambeed | 250mg | 720.81 Pln | |
| Ambeed | 1g | 2662.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A595804 |
(1R)-4-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1637540-45-4) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: (1R)-4-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: CBWNFZYQNOKVAI-SBSPUUFOSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | (1R)-4-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | CBWNFZYQNOKVAI-SBSPUUFOSA-N |
| SMILES | C1CC2=C([C@@H]1N)C=CC=C2F.Cl |
Computed by PubChem (NCBI)