CAS 879324-66-0 appears in our catalog under these names: 2-(4-Fluorophenyl)cyclopropan-1-amine hydrochloride, 95%, (2-(4-Fluorophenyl)cyclopropyl)amine hydrochloride, 2–(4–Fluorophenyl)cyclopropanamine hydrochloride, 2-(4-Fluorophenyl)cyclopropanamine hydrochloride, 98%, 98%, 2-(4-FLUOROPHENYL)CYCLOPROPANAMINE HCL, 98%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 5g, 500mg, 100mg.
2-(4-fluorophenyl)cyclopropan-1-amine;hydrochloride (CAS 879324-66-0) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: 2-(4-fluorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: ZQPBZLHQLCAFOQ-UHFFFAOYSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | 2-(4-fluorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | ZQPBZLHQLCAFOQ-UHFFFAOYSA-N |
| SMILES | C1C(C1N)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)