CAS 1637540-45-4 appears in our catalog under these names: (R)–4–Fluoroindan–1–amine hydrochloride, (R)-4-Fluoro-indan-1-ylamine hydrochloride, 95%, (R)-4-Fluoroindan-1-aMine hydrochloride, 95%, 95%, (R)-4-FLUORO-INDAN-1-YLAMINE-HCL, 98%, (R)-4-Fluoro-2,3-dihydro-1H-inden-1-amine hydrochloride, 95%. Offered by: GLPBio, Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg.
(1R)-4-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1637540-45-4) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: (1R)-4-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: CBWNFZYQNOKVAI-SBSPUUFOSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | (1R)-4-fluoro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | CBWNFZYQNOKVAI-SBSPUUFOSA-N |
| SMILES | C1CC2=C([C@@H]1N)C=CC=C2F.Cl |
Computed by PubChem (NCBI)