CAS 26568-26-3 appears in our catalog under these names: Trans-2-(4-fluorophenyl)cyclopropan-1-amine hydrochloride, 95%, trans-(2-(4-Fluorophenyl)cyclopropyl)amine Hydrochloride, trans-2-(4-Fluorophenyl)cyclopropanamine hydrochloride 95%, trans-[2-(4-Fluorophenyl)cyclopropyl]amine Hydrochloride, 95%, 95%. Offered by: Combi-blocks, TRC, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 500mg, 5g.
Trans-(1R,2S)-2-(4-fluorophenyl)cyclopropan-1-amine;hydrochloride (CAS 26568-26-3) is a chemical compound with the molecular formula C9H11ClFN and a molecular weight of 187.64 g/mol. IUPAC name: trans-(1R,2S)-2-(4-fluorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: ZQPBZLHQLCAFOQ-OULXEKPRSA-N.
| Molecular formula | C9H11ClFN |
|---|---|
| Molecular weight | 187.64 g/mol |
| IUPAC name | trans-(1R,2S)-2-(4-fluorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | ZQPBZLHQLCAFOQ-OULXEKPRSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)