(R)-4-Phenyl-3-propionyloxazolidin-2-one, 95%
cas: 160695-26-1 — see every product listed under this CAS number, including other names
(R)-4-Phenyl-3-propionyloxazolidin-2-one, 95% (CAS 160695-26-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A101806-250mg |
| cas | 160695-26-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 259.12 Pln | |
| Ambeed | 5g | 704.12 Pln | |
| Ambeed | 25g | 2756.69 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 227.60 Pln | |
| Chemat | 5g | 760.40 Pln | |
| Chemat | 25g | 2517.20 Pln | |
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 398.84 Pln | |
| Fluorochem | 5g | 1414.10 Pln | |
| Fluorochem | 25g | 4662.96 Pln | |
| BLDpharm | 250mg | 153.30 Pln | |
| BLDpharm | 1g | 275.48 Pln | |
| BLDpharm | 5g | 753.09 Pln | |
| BLDpharm | 25g | 2707.96 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(4R)-4-phenyl-3-propanoyl-1,3-oxazolidin-2-one (CAS 160695-26-1) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: (4R)-4-phenyl-3-propanoyl-1,3-oxazolidin-2-one. InChIKey: TYZVFKRBBHHHSX-JTQLQIEISA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | (4R)-4-phenyl-3-propanoyl-1,3-oxazolidin-2-one |
| InChIKey | TYZVFKRBBHHHSX-JTQLQIEISA-N |
| SMILES | CCC(=O)N1[C@@H](COC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)