Products 1368908-38-6
CAS 1368908-38-6 appears in our catalog under these names: 5-Ethoxy-2-methyl-1h-indole-3-carboxylic acid, 95%, 5-Ethoxy-2-methyl-1H-indole-3-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
5-ethoxy-2-methyl-1H-indole-3-carboxylic acid (CAS 1368908-38-6) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 5-ethoxy-2-methyl-1H-indole-3-carboxylic acid. InChIKey: RUQVBVMYRGVVIK-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 5-ethoxy-2-methyl-1H-indole-3-carboxylic acid |
| InChIKey | RUQVBVMYRGVVIK-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)NC(=C2C(=O)O)C |
Computed by PubChem (NCBI)