Products 261179-02-6

CAS 261179-02-6 is the registry number for 3-([(2E)-3-Phenylprop-2-enoyl]amino)propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

3-[[(E)-3-phenylprop-2-enoyl]amino]propanoic acid (CAS 261179-02-6) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 3-[[(E)-3-phenylprop-2-enoyl]amino]propanoic acid. InChIKey: RHVXIMHTRDBXMQ-VOTSOKGWSA-N.

Identity
Molecular formulaC12H13NO3
Molecular weight219.24 g/mol
IUPAC name3-[[(E)-3-phenylprop-2-enoyl]amino]propanoic acid
InChIKeyRHVXIMHTRDBXMQ-VOTSOKGWSA-N
SMILESC1=CC=C(C=C1)/C=C/C(=O)NCCC(=O)O

Computed by PubChem (NCBI)