CAS 105909-93-1 appears in our catalog under these names: 5-Methoxy-1,2-dimethyl-1h-indole-3-carboxylic acid, 95%, 5-Methoxy-1,2-dimethyl-1H-indole-3-carboxylic Acid, 5-Methoxy-1,2-dimethyl-1H-indole-3-carboxylic acid, 97%. Offered by: Combi-blocks, TRC, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 100mg, 500mg, 0,5g.
5-methoxy-1,2-dimethylindole-3-carboxylic acid (CAS 105909-93-1) is a chemical compound with the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. IUPAC name: 5-methoxy-1,2-dimethylindole-3-carboxylic acid. InChIKey: RJUBRYYKCHYVEP-UHFFFAOYSA-N.
| Molecular formula | C12H13NO3 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | 5-methoxy-1,2-dimethylindole-3-carboxylic acid |
| InChIKey | RJUBRYYKCHYVEP-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(N1C)C=CC(=C2)OC)C(=O)O |
Computed by PubChem (NCBI)