cas: 115186-31-7 — see every product listed under this CAS number, including other names
(R)-6-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-((tert-butoxycarbonyl)amino)hexanoic acid, 95% (CAS 115186-31-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111GE9-250mg |
| cas | 115186-31-7 |
| size | 250mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 170.00 Pln | |
| Chemat | 10g | 246.80 Pln | |
| Chemat | 25g | 453.20 Pln | |
| Chemat | 50g | 818.00 Pln | |
| Chemat | 100g | 1514.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2R)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 115186-31-7) is a chemical compound with the molecular formula C26H32N2O6 and a molecular weight of 468.5 g/mol. IUPAC name: (2R)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: JYEVQYFWINBXJU-JOCHJYFZSA-N.
| Molecular formula | C26H32N2O6 |
|---|---|
| Molecular weight | 468.5 g/mol |
| IUPAC name | (2R)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | JYEVQYFWINBXJU-JOCHJYFZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCCCNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C(=O)O |
Computed by PubChem (NCBI)