Products 219967-68-7
CAS 219967-68-7 appears in our catalog under these names: Fmoc-beta-lys(boc)-oh, 95%, (S)–3–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–6–((tert–butoxycarbonyl)amino)hexanoic acid, Fmoc-L-beta-Lys(Boc)-OH, Fmoc-β-Lys(Boc)-OH 95%, Fmoc-L-beta-Lys(Boc)-OH, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg, 0,5g, 1 g, 100 mg.
(3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 219967-68-7) is a chemical compound with the molecular formula C26H32N2O6 and a molecular weight of 468.5 g/mol. IUPAC name: (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: SETTXXCZEDLMRX-KRWDZBQOSA-N.
| Molecular formula | C26H32N2O6 |
|---|---|
| Molecular weight | 468.5 g/mol |
| IUPAC name | (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | SETTXXCZEDLMRX-KRWDZBQOSA-N |
| SMILES | CC(C)(C)OC(=O)NCCC[C@@H](CC(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)