CAS 71989-26-9 appears in our catalog under these names: Fmoc–Lys(Boc)–OH, Fmoc-Lys(Boc)-OH/ 99.89% (existing batch purity), Fmoc-L-Lys(Boc)-OH, Fmoc-Lys(Boc)-OH, 99.00%, Fmoc-Lys(Boc)-OH. Offered by: GLPBio, TargetMol, Iris Biotech, Chemat, Biosynth. Available pack sizes: 100g, 25g, 5g, 250g, 10g, 50g, 0,5kg, 0,25kg.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (CAS 71989-26-9) is a chemical compound with the molecular formula C26H32N2O6 and a molecular weight of 468.5 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid. InChIKey: UMRUUWFGLGNQLI-UHFFFAOYSA-N.
| Molecular formula | C26H32N2O6 |
|---|---|
| Molecular weight | 468.5 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| InChIKey | UMRUUWFGLGNQLI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCCCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)