CAS 1217447-72-7 appears in our catalog under these names: Fmoc-Lys(Boc)-OH-15N2, Fmoc–L–Lys (Boc)–OH–15N2, Fmoc-L-Lys (Boc)-OH-15N2. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 25mg, 1mg, 10mg, 5mg, 10 mg, 1 mg, 50 mg, 25 mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-6-[(2-methylpropan-2-yl)oxycarbonyl(15N)amino]hexanoic acid (CAS 1217447-72-7) is a chemical compound with the molecular formula C26H32N2O6 and a molecular weight of 470.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-6-[(2-methylpropan-2-yl)oxycarbonyl(15N)amino]hexanoic acid. InChIKey: UMRUUWFGLGNQLI-SBAWBPENSA-N.
| Molecular formula | C26H32N2O6 |
|---|---|
| Molecular weight | 470.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-6-[(2-methylpropan-2-yl)oxycarbonyl(15N)amino]hexanoic acid |
| InChIKey | UMRUUWFGLGNQLI-SBAWBPENSA-N |
| SMILES | CC(C)(C)OC(=O)[15NH]CCCC[C@@H](C(=O)O)[15NH]C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)